CAS 1807939-16-7 appears in our catalog under these names: tert-Butyl 3-(N'-hydroxycarbamimidoyl)-4-methylpiperazine-1-carboxylate, 95%, tert-Butyl 3-(N'-hydroxycarbamimidoyl)-4-methylpiperazine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-4-methylpiperazine-1-carboxylate (CAS 1807939-16-7) is a chemical compound with the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. IUPAC name: tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-4-methylpiperazine-1-carboxylate. InChIKey: MIUGCVJUQPEOQA-UHFFFAOYSA-N.
| Molecular formula | C11H22N4O3 |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-4-methylpiperazine-1-carboxylate |
| InChIKey | MIUGCVJUQPEOQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)/C(=N/O)/N)C |
Computed by PubChem (NCBI)