CAS 1936693-27-4 is the registry number for 1-Boc-4-hydroxycarbamimidoylmethyl piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylpiperazine-1-carboxylate (CAS 1936693-27-4) is a chemical compound with the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. IUPAC name: tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylpiperazine-1-carboxylate. InChIKey: HNAIPTNAFIELPJ-UHFFFAOYSA-N.
| Molecular formula | C11H22N4O3 |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]-2-methylpiperazine-1-carboxylate |
| InChIKey | HNAIPTNAFIELPJ-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1C(=O)OC(C)(C)C)/C(=N\O)/N |
Computed by PubChem (NCBI)