CAS 1311390-87-0 is the registry number for tert-butyl (1S,4R,6R)-rel-6-amino-2-azabicyclo(2.2.2)octane-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl (1S,4R,6R)-6-amino-2-azabicyclo[2.2.2]octane-2-carboxylate (CAS 1311390-87-0) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (1S,4R,6R)-6-amino-2-azabicyclo[2.2.2]octane-2-carboxylate. InChIKey: VOJMZLZBOIHIRI-BBBLOLIVSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (1S,4R,6R)-6-amino-2-azabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | VOJMZLZBOIHIRI-BBBLOLIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]1[C@@H](C2)N |
Computed by PubChem (NCBI)