Products 131172-61-7
CAS 131172-61-7 is the registry number for 5-(4-Chlorophenyl)-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid (CAS 131172-61-7) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: KIUIWIJLBPLGPN-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | KIUIWIJLBPLGPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)