CAS 13124-09-9 is the registry number for 2-(3,4-Dichlorophenyl)hydrazinecarbothioamide, 95+%. Offered by: AmBeed. Available pack sizes: 10g.
(3,4-dichloroanilino)thiourea (CAS 13124-09-9) is a chemical compound with the molecular formula C7H7Cl2N3S and a molecular weight of 236.12 g/mol. IUPAC name: (3,4-dichloroanilino)thiourea. InChIKey: KFDCINBRGZTQLH-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3S |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | (3,4-dichloroanilino)thiourea |
| InChIKey | KFDCINBRGZTQLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NNC(=S)N)Cl)Cl |
Computed by PubChem (NCBI)