CAS 38901-32-5 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)-3-thiosemicarbazide, 95%, 4-(3,4-Dichlorophenyl)-3-thiosemicarbazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
1-amino-3-(3,4-dichlorophenyl)thiourea (CAS 38901-32-5) is a chemical compound with the molecular formula C7H7Cl2N3S and a molecular weight of 236.12 g/mol. IUPAC name: 1-amino-3-(3,4-dichlorophenyl)thiourea. InChIKey: QGZUHVBYSLKJHG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3S |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1-amino-3-(3,4-dichlorophenyl)thiourea |
| InChIKey | QGZUHVBYSLKJHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=S)NN)Cl)Cl |
Computed by PubChem (NCBI)