CAS 73305-13-2 is the registry number for N-(2,4-Dichlorophenyl)hydrazinecarbothioamide, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
1-amino-3-(2,4-dichlorophenyl)thiourea (CAS 73305-13-2) is a chemical compound with the molecular formula C7H7Cl2N3S and a molecular weight of 236.12 g/mol. IUPAC name: 1-amino-3-(2,4-dichlorophenyl)thiourea. InChIKey: PEWKSNLNCRYBNV-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3S |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1-amino-3-(2,4-dichlorophenyl)thiourea |
| InChIKey | PEWKSNLNCRYBNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=S)NN |
Computed by PubChem (NCBI)