Products 1312542-39-4
CAS 1312542-39-4 is the registry number for Rel-methyl (1R,3aR,7aS)-3-oxooctahydro-1H-isoindole-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1R,3aR,7aS)-3-oxo-1,2,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylate (CAS 1312542-39-4) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: methyl (1R,3aR,7aS)-3-oxo-1,2,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylate. InChIKey: PDQOHOWNIRTCFI-XLPZGREQSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | methyl (1R,3aR,7aS)-3-oxo-1,2,3a,4,5,6,7,7a-octahydroisoindole-1-carboxylate |
| InChIKey | PDQOHOWNIRTCFI-XLPZGREQSA-N |
| SMILES | COC(=O)[C@H]1[C@H]2CCCC[C@H]2C(=O)N1 |
Computed by PubChem (NCBI)