Products 1312697-61-2
CAS 1312697-61-2 is the registry number for Methyl 2-chloro-6-[2-(dimethylamino)ethenyl]-3-pyridinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-chloro-6-[(E)-2-(dimethylamino)ethenyl]pyridine-3-carboxylate (CAS 1312697-61-2) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: methyl 2-chloro-6-[(E)-2-(dimethylamino)ethenyl]pyridine-3-carboxylate. InChIKey: RXRLTRWOMXZMRL-VOTSOKGWSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | methyl 2-chloro-6-[(E)-2-(dimethylamino)ethenyl]pyridine-3-carboxylate |
| InChIKey | RXRLTRWOMXZMRL-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C1=NC(=C(C=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)