CAS 1469931-07-4 is the registry number for (2,4,6-Trimethylpyrimidin-5-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4,6-trimethylpyrimidin-5-yl)boronic acid (CAS 1469931-07-4) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. IUPAC name: (2,4,6-trimethylpyrimidin-5-yl)boronic acid. InChIKey: NVCUISXMBALXQA-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 165.99 g/mol |
| IUPAC name | (2,4,6-trimethylpyrimidin-5-yl)boronic acid |
| InChIKey | NVCUISXMBALXQA-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(N=C1C)C)C)(O)O |
Computed by PubChem (NCBI)