Products 871579-11-2
CAS 871579-11-2 appears in our catalog under these names: t-Butyl Z-L-Alaninamide, 96%, T-Butyl Z-L-Alaninamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Benzyl N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]carbamate (CAS 871579-11-2) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: benzyl N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]carbamate. InChIKey: YPUQFTVEQMBYMB-NSHDSACASA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]carbamate |
| InChIKey | YPUQFTVEQMBYMB-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)NC(C)(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)