CAS 1313436-97-3 is the registry number for 8-Oxoeremophil-6-en-12-oic aicd. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(4aR,8S,8aR)-8,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalen-2-yl]propanoic acid (CAS 1313436-97-3) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: 2-[(4aR,8S,8aR)-8,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalen-2-yl]propanoic acid. InChIKey: HGWXWGKXIKVBKD-KSIFUHMZSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | 2-[(4aR,8S,8aR)-8,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalen-2-yl]propanoic acid |
| InChIKey | HGWXWGKXIKVBKD-KSIFUHMZSA-N |
| SMILES | C[C@H]1CCC[C@H]2[C@@]1(C=C(C(=O)C2)C(C)C(=O)O)C |
Computed by PubChem (NCBI)