Products 1313712-14-9

CAS 1313712-14-9 is the registry number for 4-[2-(4-Fluoro-phenyl)-ethyl]-1h-pyrrole-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 4-[2-(4-fluorophenyl)ethyl]-1H-pyrrole-3-carboxylate (CAS 1313712-14-9) is a chemical compound with the molecular formula C14H14FNO2 and a molecular weight of 247.26 g/mol. IUPAC name: methyl 4-[2-(4-fluorophenyl)ethyl]-1H-pyrrole-3-carboxylate. InChIKey: XUICAJMFKIEYTM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14FNO2
Molecular weight247.26 g/mol
IUPAC namemethyl 4-[2-(4-fluorophenyl)ethyl]-1H-pyrrole-3-carboxylate
InChIKeyXUICAJMFKIEYTM-UHFFFAOYSA-N
SMILESCOC(=O)C1=CNC=C1CCC2=CC=C(C=C2)F

Computed by PubChem (NCBI)