CAS 1982594-31-9 is the registry number for 3-Fluoro-3',4'-dimethoxy-[1,1'-biphenyl]-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethoxyphenyl)-6-fluoroaniline (CAS 1982594-31-9) is a chemical compound with the molecular formula C14H14FNO2 and a molecular weight of 247.26 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-6-fluoroaniline. InChIKey: LPLFPYRJJWDGQY-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO2 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-6-fluoroaniline |
| InChIKey | LPLFPYRJJWDGQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=CC=C2)F)N)OC |
Computed by PubChem (NCBI)