Products 876294-75-6
CAS 876294-75-6 is the registry number for 1-(4-Fluorobenzyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid (CAS 876294-75-6) is a chemical compound with the molecular formula C14H14FNO2 and a molecular weight of 247.26 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: GSDMGAGFDOQHKA-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO2 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | GSDMGAGFDOQHKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=C(C=C2)F)C)C(=O)O |
Computed by PubChem (NCBI)