Products 1313716-46-9
CAS 1313716-46-9 is the registry number for (2S)-8-Methyl-8-aza-bicyclo[3.2.1]octan-3-yl 3-(methylsulfonyloxy)-2-phenylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[(2S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl] 3-methylsulfonyl-2-phenylpropanoate (CAS 1313716-46-9) is a chemical compound with the molecular formula C17H23NO4S and a molecular weight of 337.4 g/mol. IUPAC name: [(2S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl] 3-methylsulfonyl-2-phenylpropanoate. InChIKey: PMDYMFNHVLPGQE-AUSYRVNMSA-N.
| Molecular formula | C17H23NO4S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [(2S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl] 3-methylsulfonyl-2-phenylpropanoate |
| InChIKey | PMDYMFNHVLPGQE-AUSYRVNMSA-N |
| SMILES | CN1C2CCC1[C@H](C2)OC(=O)C(CS(=O)(=O)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)