Products 397264-10-7

CAS 397264-10-7 is the registry number for Ph-S-Pip(Boc)-OH. Offered by: Iris Biotech. Available pack sizes: 5g, 25g.

Structural formula: {0} (CAS {1})

1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpiperidine-4-carboxylic acid (CAS 397264-10-7) is a chemical compound with the molecular formula C17H23NO4S and a molecular weight of 337.4 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpiperidine-4-carboxylic acid. InChIKey: WLDQIRTWQMYIOH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO4S
Molecular weight337.4 g/mol
IUPAC name1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylsulfanylpiperidine-4-carboxylic acid
InChIKeyWLDQIRTWQMYIOH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)SC2=CC=CC=C2

Computed by PubChem (NCBI)