Products 326182-73-4
CAS 326182-73-4 is the registry number for 3-({1,3,3-trimethyl-6-azabicyclo(3.2.1)octan-6-yl}sulfonyl)benzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoic acid (CAS 326182-73-4) is a chemical compound with the molecular formula C17H23NO4S and a molecular weight of 337.4 g/mol. IUPAC name: 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoic acid. InChIKey: ZBSYCERXWWNIEZ-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 3-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)sulfonyl]benzoic acid |
| InChIKey | ZBSYCERXWWNIEZ-UHFFFAOYSA-N |
| SMILES | CC1(CC2CC(C1)(CN2S(=O)(=O)C3=CC=CC(=C3)C(=O)O)C)C |
Computed by PubChem (NCBI)