Products 160306-22-9

CAS 160306-22-9 is the registry number for Ethyl 5-(diethylamino)-2-(phenylsulfonyl)penta-2,4-dienoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate (CAS 160306-22-9) is a chemical compound with the molecular formula C17H23NO4S and a molecular weight of 337.4 g/mol. IUPAC name: ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate. InChIKey: WWFPHONPCQANDG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO4S
Molecular weight337.4 g/mol
IUPAC nameethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate
InChIKeyWWFPHONPCQANDG-UHFFFAOYSA-N
SMILESCCN(CC)C=CC=C(C(=O)OCC)S(=O)(=O)C1=CC=CC=C1

Computed by PubChem (NCBI)