CAS 1313738-67-8 appears in our catalog under these names: 3-Amino-5-bromo-pyridine-2-carboxylic acid isopropyl ester, 95%, Isopropyl 3-amino-5-bromopicolinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g.
Propan-2-yl 3-amino-5-bromopyridine-2-carboxylate (CAS 1313738-67-8) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: propan-2-yl 3-amino-5-bromopyridine-2-carboxylate. InChIKey: LQRPKKCXPFUUNP-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | propan-2-yl 3-amino-5-bromopyridine-2-carboxylate |
| InChIKey | LQRPKKCXPFUUNP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=C(C=N1)Br)N |
Computed by PubChem (NCBI)