Products 1313741-00-2

CAS 1313741-00-2 is the registry number for HJ-4, 98.02%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(2-methoxyphenyl)piperazin-1-yl]penta-2,4-dien-1-one (CAS 1313741-00-2) is a chemical compound with the molecular formula C23H24N2O4 and a molecular weight of 392.4 g/mol. IUPAC name: (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(2-methoxyphenyl)piperazin-1-yl]penta-2,4-dien-1-one. InChIKey: YJMIFRFZGOUBRN-VDESZNBCSA-N.

Identity
Molecular formulaC23H24N2O4
Molecular weight392.4 g/mol
IUPAC name(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-[4-(2-methoxyphenyl)piperazin-1-yl]penta-2,4-dien-1-one
InChIKeyYJMIFRFZGOUBRN-VDESZNBCSA-N
SMILESCOC1=CC=CC=C1N2CCN(CC2)C(=O)/C=C/C=C/C3=CC4=C(C=C3)OCO4

Computed by PubChem (NCBI)

Synonyms: orb3173398