CAS 1313762-34-3 is the registry number for N-(3,6-Dimethylpyridin-2-yl)pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(3,6-dimethyl-2-pyridinyl)-2,2-dimethylpropanamide (CAS 1313762-34-3) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: N-(3,6-dimethyl-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: JEEUXDSIBQARBY-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | N-(3,6-dimethyl-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | JEEUXDSIBQARBY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1)C)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)