CAS 1313815-37-0 is the registry number for 3-(Pyrazin-2-yl)-1,2,4-oxadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid (CAS 1313815-37-0) is a chemical compound with the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. IUPAC name: 3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: YSLWFMVPQCLGIV-UHFFFAOYSA-N.
| Molecular formula | C7H4N4O3 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | YSLWFMVPQCLGIV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NOC(=N2)C(=O)O |
Computed by PubChem (NCBI)