Products 1313815-37-0

CAS 1313815-37-0 is the registry number for 3-(Pyrazin-2-yl)-1,2,4-oxadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid (CAS 1313815-37-0) is a chemical compound with the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. IUPAC name: 3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: YSLWFMVPQCLGIV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4N4O3
Molecular weight192.13 g/mol
IUPAC name3-pyrazin-2-yl-1,2,4-oxadiazole-5-carboxylic acid
InChIKeyYSLWFMVPQCLGIV-UHFFFAOYSA-N
SMILESC1=CN=C(C=N1)C2=NOC(=N2)C(=O)O

Computed by PubChem (NCBI)