CAS 2140305-32-2 appears in our catalog under these names: 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one, 95%, 6-Nitropyrido(2,3-d)pyrimidin-4(3H)-one. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg.
6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2140305-32-2) is a chemical compound with the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. IUPAC name: 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: IHNPSZKFGZXAEL-UHFFFAOYSA-N.
| Molecular formula | C7H4N4O3 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | IHNPSZKFGZXAEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=O)NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)