Products 68165-29-7
CAS 68165-29-7 appears in our catalog under these names: 7-Hydroxypteridine-6-carboxylic acid, 7-Hydroxypteridine-6-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
7-oxo-8H-pteridine-6-carboxylic acid (CAS 68165-29-7) is a chemical compound with the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. IUPAC name: 7-oxo-8H-pteridine-6-carboxylic acid. InChIKey: ININMFLHQXATDK-UHFFFAOYSA-N.
| Molecular formula | C7H4N4O3 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 7-oxo-8H-pteridine-6-carboxylic acid |
| InChIKey | ININMFLHQXATDK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC=N1)NC(=O)C(=N2)C(=O)O |
Computed by PubChem (NCBI)