CAS 205756-46-3 is the registry number for N-(3,4-Difluorophenyl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,4-difluorophenyl)-2,2-dimethylpropanamide (CAS 205756-46-3) is a chemical compound with the molecular formula C11H13F2NO and a molecular weight of 213.22 g/mol. IUPAC name: N-(3,4-difluorophenyl)-2,2-dimethylpropanamide. InChIKey: GDCSMKQNTXLXRD-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO |
|---|---|
| Molecular weight | 213.22 g/mol |
| IUPAC name | N-(3,4-difluorophenyl)-2,2-dimethylpropanamide |
| InChIKey | GDCSMKQNTXLXRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)