CAS 1314355-66-2 appears in our catalog under these names: 4–(1H–Pyrazol–1–yl)pyridin–2–amine, 4-(1H-Pyrazol-1-yl)pyridin-2-amine, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
4-pyrazol-1-ylpyridin-2-amine (CAS 1314355-66-2) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 4-pyrazol-1-ylpyridin-2-amine. InChIKey: ZTKJAUMUNNGHDM-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 4-pyrazol-1-ylpyridin-2-amine |
| InChIKey | ZTKJAUMUNNGHDM-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC(=NC=C2)N |
Computed by PubChem (NCBI)