CAS 13144-88-2 is the registry number for 1,3,3,4,4-Pentamethyl-2-acetyl-1-cyclopentene. Offered by: TRC. Available pack sizes: 10mg, 250mg, 25mg.
1-(2,4,4,5,5-pentamethylcyclopenten-1-yl)ethanone (CAS 13144-88-2) is a chemical compound with the molecular formula C12H20O and a molecular weight of 180.29 g/mol. IUPAC name: 1-(2,4,4,5,5-pentamethylcyclopenten-1-yl)ethanone. InChIKey: LLCMOZBDJDCWLT-UHFFFAOYSA-N.
| Molecular formula | C12H20O |
|---|---|
| Molecular weight | 180.29 g/mol |
| IUPAC name | 1-(2,4,4,5,5-pentamethylcyclopenten-1-yl)ethanone |
| InChIKey | LLCMOZBDJDCWLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(C1)(C)C)(C)C)C(=O)C |
Computed by PubChem (NCBI)