Products 1314406-45-5
CAS 1314406-45-5 is the registry number for 2-Chloro-6-(methylsulfonamido)benzoic acid, >95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-6-(methanesulfonamido)benzoic acid (CAS 1314406-45-5) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: 2-chloro-6-(methanesulfonamido)benzoic acid. InChIKey: OUNMXLSKIJRUNZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | 2-chloro-6-(methanesulfonamido)benzoic acid |
| InChIKey | OUNMXLSKIJRUNZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)