CAS 1314667-66-7 appears in our catalog under these names: 1-(5-Bromo-2-fluorophenyl)cyclobutane-1-carboxylic acid, 95%, 1-(5-Bromo-2-fluorophenyl)cyclobutane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(5-bromo-2-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 1314667-66-7) is a chemical compound with the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: ZHLJWZMVDSAWOS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO2 |
|---|---|
| Molecular weight | 273.10 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | ZHLJWZMVDSAWOS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=CC(=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)