Products 1314713-02-4
CAS 1314713-02-4 appears in our catalog under these names: 1-(2-Hydroxyphenyl)cyclopropane-1-carboxylic Acid, 1-(2-Hydroxyphenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: TRC, AmBeed. Available pack sizes: 1g.
1-(2-hydroxyphenyl)cyclopropane-1-carboxylic acid (CAS 1314713-02-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 1-(2-hydroxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: WEMDSNKKGGWRNS-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 1-(2-hydroxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WEMDSNKKGGWRNS-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2O)C(=O)O |
Computed by PubChem (NCBI)