CAS 1314735-95-9 appears in our catalog under these names: 2–(4–chloro–2–methylphenyl)propan–2–amine hydrochloride, 2-(4-chloro-2-methylphenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
2-(4-chloro-2-methylphenyl)propan-2-amine (CAS 1314735-95-9) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 2-(4-chloro-2-methylphenyl)propan-2-amine. InChIKey: IFRZXVOERFRUEV-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenyl)propan-2-amine |
| InChIKey | IFRZXVOERFRUEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(C)(C)N |
Computed by PubChem (NCBI)