CAS 1314907-71-5 appears in our catalog under these names: Ibuprofen Impurity 24, 1-(4-(1-Hydroxy-2-methylpropyl)phenyl)ethanone, >95% (HPLC), 4-(1-Hydroxy-2-methylpropyl)acetophenone. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 250mg, 50mg.
1-[4-(1-hydroxy-2-methylpropyl)phenyl]ethanone (CAS 1314907-71-5) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-[4-(1-hydroxy-2-methylpropyl)phenyl]ethanone. InChIKey: YOUODLUMPRHZCA-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-[4-(1-hydroxy-2-methylpropyl)phenyl]ethanone |
| InChIKey | YOUODLUMPRHZCA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)C(=O)C)O |
Computed by PubChem (NCBI)