CAS 1314933-28-2 is the registry number for 2-tert-Butyl-4H,5H-pyrazolo(1,5-a)pyrazin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-tert-butyl-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1314933-28-2) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 2-tert-butyl-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: ABAOXCFCCXHQME-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 2-tert-butyl-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | ABAOXCFCCXHQME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN2C=CNC(=O)C2=C1 |
Computed by PubChem (NCBI)