CAS 1314952-26-5 appears in our catalog under these names: Rac-(1r,2r)-2-(benzyloxy)cyclopentan-1-amine hydrochloride, 95%, rel-(1R,2R)-2-(Benzyloxy)cyclopentan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine;hydrochloride (CAS 1314952-26-5) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine;hydrochloride. InChIKey: YKVRQNSFUGFHHJ-MNMPKAIFSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine;hydrochloride |
| InChIKey | YKVRQNSFUGFHHJ-MNMPKAIFSA-N |
| SMILES | C1C[C@H]([C@@H](C1)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)