CAS 13152-94-8 is the registry number for 3,4'-Dimethylbenzophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-methylphenyl)-(4-methylphenyl)methanone (CAS 13152-94-8) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (3-methylphenyl)-(4-methylphenyl)methanone. InChIKey: YMDBXBBWNOELNV-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (3-methylphenyl)-(4-methylphenyl)methanone |
| InChIKey | YMDBXBBWNOELNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)