CAS 1315367-35-1 appears in our catalog under these names: 3,6-Dibromo-8-fluoroquinoline, 95%, 3,6-Dibromo-8-fluoroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,6-dibromo-8-fluoroquinoline (CAS 1315367-35-1) is a chemical compound with the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. IUPAC name: 3,6-dibromo-8-fluoroquinoline. InChIKey: IUVCBIMGTGFGFN-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2FN |
|---|---|
| Molecular weight | 304.94 g/mol |
| IUPAC name | 3,6-dibromo-8-fluoroquinoline |
| InChIKey | IUVCBIMGTGFGFN-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=NC2=C(C=C1Br)F)Br |
Computed by PubChem (NCBI)