CAS 1693576-55-4 is the registry number for 2,8-Dibromo-5-fluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dibromo-5-fluoroquinoline (CAS 1693576-55-4) is a chemical compound with the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. IUPAC name: 2,8-dibromo-5-fluoroquinoline. InChIKey: ASMWYKLXSVIGSI-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2FN |
|---|---|
| Molecular weight | 304.94 g/mol |
| IUPAC name | 2,8-dibromo-5-fluoroquinoline |
| InChIKey | ASMWYKLXSVIGSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C=CC(=C21)F)Br)Br |
Computed by PubChem (NCBI)