CAS 1841444-16-3 is the registry number for 3,7-Dibromo-6-fluoroisoquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 250mg.
3,7-dibromo-6-fluoroisoquinoline (CAS 1841444-16-3) is a chemical compound with the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. IUPAC name: 3,7-dibromo-6-fluoroisoquinoline. InChIKey: IQFKOIBAKUVFLU-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2FN |
|---|---|
| Molecular weight | 304.94 g/mol |
| IUPAC name | 3,7-dibromo-6-fluoroisoquinoline |
| InChIKey | IQFKOIBAKUVFLU-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=CC2=CC(=C1F)Br)Br |
Computed by PubChem (NCBI)