Products 1315367-93-1
CAS 1315367-93-1 appears in our catalog under these names: 3-(3-Aminopropyl)-1-phenyl-1h-pyrazol-5-amine dihydrochloride, 95%, 3-(3-Aminopropyl)-1-phenyl-1H-pyrazol-5-amine Dihydrochloride. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
3-(3-aminopropyl)-1-phenylpyrazol-5-amine;dihydrochloride (CAS 1315367-93-1) is a chemical compound with the molecular formula C12H18Cl2N4 and a molecular weight of 289.20 g/mol. IUPAC name: 3-(3-aminopropyl)-1-phenylpyrazol-5-amine;dihydrochloride. InChIKey: KEBRPUWXWBMMIX-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N4 |
|---|---|
| Molecular weight | 289.20 g/mol |
| IUPAC name | 3-(3-aminopropyl)-1-phenylpyrazol-5-amine;dihydrochloride |
| InChIKey | KEBRPUWXWBMMIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)CCCN)N.Cl.Cl |
Computed by PubChem (NCBI)