Products 1371098-89-3
CAS 1371098-89-3 is the registry number for 3-(3-Chloro-1H-1,2,4-triazol-1-yl)adamantan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-amine;hydrochloride (CAS 1371098-89-3) is a chemical compound with the molecular formula C12H18Cl2N4 and a molecular weight of 289.20 g/mol. IUPAC name: 3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-amine;hydrochloride. InChIKey: TYOQRVAPGIZLMJ-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N4 |
|---|---|
| Molecular weight | 289.20 g/mol |
| IUPAC name | 3-(3-chloro-1,2,4-triazol-1-yl)adamantan-1-amine;hydrochloride |
| InChIKey | TYOQRVAPGIZLMJ-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N4C=NC(=N4)Cl)N.Cl |
Computed by PubChem (NCBI)