CAS 1361113-44-1 is the registry number for 1-Methyl-3-(piperidin-3-yl)-1H-pyrazolo[3,4-b]pyridine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-3-piperidin-3-ylpyrazolo[3,4-b]pyridine;dihydrochloride (CAS 1361113-44-1) is a chemical compound with the molecular formula C12H18Cl2N4 and a molecular weight of 289.20 g/mol. IUPAC name: 1-methyl-3-piperidin-3-ylpyrazolo[3,4-b]pyridine;dihydrochloride. InChIKey: DVSRABQBLNJRQO-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N4 |
|---|---|
| Molecular weight | 289.20 g/mol |
| IUPAC name | 1-methyl-3-piperidin-3-ylpyrazolo[3,4-b]pyridine;dihydrochloride |
| InChIKey | DVSRABQBLNJRQO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=N2)C(=N1)C3CCCNC3.Cl.Cl |
Computed by PubChem (NCBI)