CAS 1315368-54-7 appears in our catalog under these names: 2-(4-Nitrophenyl)-5-(propan-2-yl)-1,3-oxazole, 95%, 2-(4-Nitrophenyl)-5-(propan-2-yl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(4-nitrophenyl)-5-propan-2-yl-1,3-oxazole (CAS 1315368-54-7) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-5-propan-2-yl-1,3-oxazole. InChIKey: PHIVFTGTDDTQRN-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-5-propan-2-yl-1,3-oxazole |
| InChIKey | PHIVFTGTDDTQRN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN=C(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)