CAS 1315369-05-1 is the registry number for 4-(Cyclopropylmethoxy)-2-fluoroaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(cyclopropylmethoxy)-2-fluoroaniline;hydrochloride (CAS 1315369-05-1) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 4-(cyclopropylmethoxy)-2-fluoroaniline;hydrochloride. InChIKey: DJTJHYVZDMONHS-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 4-(cyclopropylmethoxy)-2-fluoroaniline;hydrochloride |
| InChIKey | DJTJHYVZDMONHS-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=CC(=C(C=C2)N)F.Cl |
Computed by PubChem (NCBI)