Products 1315375-47-3
CAS 1315375-47-3 is the registry number for [1-(3,5-dichlorophenyl)cyclopropyl]methanamine, >95%. Offered by: Chemat. Available pack sizes: 100mg.
[1-(3,5-dichlorophenyl)cyclopropyl]methanamine (CAS 1315375-47-3) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: [1-(3,5-dichlorophenyl)cyclopropyl]methanamine. InChIKey: INJGOQSDUYRJGU-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | [1-(3,5-dichlorophenyl)cyclopropyl]methanamine |
| InChIKey | INJGOQSDUYRJGU-UHFFFAOYSA-N |
| SMILES | C1CC1(CN)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)