CAS 1315449-93-4 is the registry number for N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-fluoro-α-methyl-D-phenylalanine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)-2-methylpropanoic acid (CAS 1315449-93-4) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)-2-methylpropanoic acid. InChIKey: VNYGHKCAXQKZEQ-RUZDIDTESA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | VNYGHKCAXQKZEQ-RUZDIDTESA-N |
| SMILES | C[C@@](CC1=CC=CC=C1F)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)