CAS 1315544-54-7 appears in our catalog under these names: 5-Bromo-n-ethyl-2-methoxynicotinamide, 95%, 5–Bromo–N–ethyl–2–methoxynicotinamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-N-ethyl-2-methoxypyridine-3-carboxamide (CAS 1315544-54-7) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 5-bromo-N-ethyl-2-methoxypyridine-3-carboxamide. InChIKey: LVFXTXUJVXIVCB-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-bromo-N-ethyl-2-methoxypyridine-3-carboxamide |
| InChIKey | LVFXTXUJVXIVCB-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(N=CC(=C1)Br)OC |
Computed by PubChem (NCBI)