CAS 552850-73-4 appears in our catalog under these names: Edoxaban Impurity 78, 2-((5-Chloropyridin-2-yl)amino)-2-oxoacetic Acid, >95% (HPLC), 2–((5–Chloro–2–pyridinyl)amino)–2–oxo–acetic acid, Acetic acid, 2-[(5-chloro-2-pyridinyl)amino]-2-oxo-, 97%, 97%, 2-((5-CHLOROPYRIDIN-2-YL)AMINO)-2-OXOACETIC ACID, 97%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 1g, 25g, 5g, 250mg, 10g, 100g, 500g.
2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetic acid (CAS 552850-73-4) is a chemical compound with the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. IUPAC name: 2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetic acid. InChIKey: UQMUSEDZBHNTTQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3 |
|---|---|
| Molecular weight | 200.58 g/mol |
| IUPAC name | 2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetic acid |
| InChIKey | UQMUSEDZBHNTTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)NC(=O)C(=O)O |
Computed by PubChem (NCBI)