Products 131651-38-2
CAS 131651-38-2 is the registry number for Turmeronol B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6S)-6-(2-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one (CAS 131651-38-2) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (6S)-6-(2-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one. InChIKey: WYIJOOQDLOBLCP-LBPRGKRZSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (6S)-6-(2-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one |
| InChIKey | WYIJOOQDLOBLCP-LBPRGKRZSA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](C)CC(=O)C=C(C)C)O |
Computed by PubChem (NCBI)