CAS 131669-11-9 appears in our catalog under these names: Fmoc-Arg-OH.HCl, Fmoc–Arg–OH·HCl, Fmoc-Arg-OH.HCl 98%, N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-arginine hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 0,5kg, 1kg, 2kg, 10kg, 5kg.
(2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride (CAS 131669-11-9) is a chemical compound with the molecular formula C21H25ClN4O4 and a molecular weight of 432.9 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride. InChIKey: GKVPGWVXDVZUBA-FERBBOLQSA-N.
| Molecular formula | C21H25ClN4O4 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride |
| InChIKey | GKVPGWVXDVZUBA-FERBBOLQSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN=C(N)N)C(=O)O.Cl |
Computed by PubChem (NCBI)